C9H4BrCl2NO — CID 171008228
4-(2-bromoacetyl)-2,3-dichlorobenzonitrile (PubChem CID 171008228) has the molecular formula C9H4BrCl2NO and a molecular weight of 292.95 g/mol. Its IUPAC name is 4-(2-bromoacetyl)-2,3-dichlorobenzonitrile.
| Compound Name | 4-(2-bromoacetyl)-2,3-dichlorobenzonitrile |
|---|---|
| PubChem CID | 171008228 |
| Molecular Formula | C9H4BrCl2NO |
| Molecular Weight | 292.95 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | 4-(2-bromoacetyl)-2,3-dichlorobenzonitrile |
| SMILES | N#Cc1ccc(C(=O)CBr)c(Cl)c1Cl |
| InChI | InChI=1S/C9H4BrCl2NO/c10-3-7(14)6-2-1-5(4-13)8(11)9(6)12/h1-2H,3H2 |
| InChIKey | VDTXKNIHXYIHIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.95 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|