2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid

C8H5Br2FO3 — CID 171008427

IUPAC2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cc(Br)cc(Br)c1F
InChIInChI=1S/C8H5Br2FO3/c9-3-1-4(7(12)8(13)14)6(11)5(10)2-3/h1-2,7,12H,(H,13,14)
InChIKeySTNAILQPMMCWTM-UHFFFAOYSA-N
MW327.93 g/mol
LogP2.47
Rot. Bonds2

About 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid

2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid (PubChem CID 171008427) has the molecular formula C8H5Br2FO3 and a molecular weight of 327.93 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid
PubChem CID171008427
Molecular FormulaC8H5Br2FO3
Molecular Weight327.93 g/mol
Exact Mass325.86
IUPAC Name2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cc(Br)cc(Br)c1F
InChIInChI=1S/C8H5Br2FO3/c9-3-1-4(7(12)8(13)14)6(11)5(10)2-3/h1-2,7,12H,(H,13,14)
InChIKeySTNAILQPMMCWTM-UHFFFAOYSA-N
XLogP2.47
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.93
LogP ≤ 52.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid (CID 171008427) is 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid is O=C(O)C(O)c1cc(Br)cc(Br)c1F.
What is the InChIKey of 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid?
The InChIKey is STNAILQPMMCWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2FO3/c9-3-1-4(7(12)8(13)14)6(11)5(10)2-3/h1-2,7,12H,(H,13,14).
What are the key properties of 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid?
2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid has a molecular weight of 327.93 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dibromo-2-fluorophenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 171008427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).