2-(2,6-diamino-3-methoxyphenyl)acetic acid

C9H12N2O3 — CID 171010490

IUPAC2-(2,6-diamino-3-methoxyphenyl)acetic acid
SMILESCOc1ccc(N)c(CC(=O)O)c1N
InChIInChI=1S/C9H12N2O3/c1-14-7-3-2-6(10)5(9(7)11)4-8(12)13/h2-3H,4,10-11H2,1H3,(H,12,13)
InChIKeyHPYIILAOORMWBX-UHFFFAOYSA-N
MW196.21 g/mol
LogP0.49
Rot. Bonds3

About 2-(2,6-diamino-3-methoxyphenyl)acetic acid

2-(2,6-diamino-3-methoxyphenyl)acetic acid (PubChem CID 171010490) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(2,6-diamino-3-methoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-(2,6-diamino-3-methoxyphenyl)acetic acid
PubChem CID171010490
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Name2-(2,6-diamino-3-methoxyphenyl)acetic acid
SMILESCOc1ccc(N)c(CC(=O)O)c1N
InChIInChI=1S/C9H12N2O3/c1-14-7-3-2-6(10)5(9(7)11)4-8(12)13/h2-3H,4,10-11H2,1H3,(H,12,13)
InChIKeyHPYIILAOORMWBX-UHFFFAOYSA-N
XLogP0.49
TPSA98.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 50.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(2,6-diamino-3-methoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-diamino-3-methoxyphenyl)acetic acid?
The IUPAC name of 2-(2,6-diamino-3-methoxyphenyl)acetic acid (CID 171010490) is 2-(2,6-diamino-3-methoxyphenyl)acetic acid.
What is the SMILES notation for 2-(2,6-diamino-3-methoxyphenyl)acetic acid?
The canonical SMILES for 2-(2,6-diamino-3-methoxyphenyl)acetic acid is COc1ccc(N)c(CC(=O)O)c1N.
What is the InChIKey of 2-(2,6-diamino-3-methoxyphenyl)acetic acid?
The InChIKey is HPYIILAOORMWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-14-7-3-2-6(10)5(9(7)11)4-8(12)13/h2-3H,4,10-11H2,1H3,(H,12,13).
What are the key properties of 2-(2,6-diamino-3-methoxyphenyl)acetic acid?
2-(2,6-diamino-3-methoxyphenyl)acetic acid has a molecular weight of 196.21 g/mol, XLogP of 0.49, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diamino-3-methoxyphenyl)acetic acid is sourced from PubChem (CID 171010490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).