C19H15N5O3 — CID 17101128
N-(1-ethylpyrazolo[3,4-b]quinolin-3-yl)-3-nitrobenzamide (PubChem CID 17101128) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-(1-ethylpyrazolo[3,4-b]quinolin-3-yl)-3-nitrobenzamide.
| Compound Name | N-(1-ethylpyrazolo[3,4-b]quinolin-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 17101128 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(1-ethylpyrazolo[3,4-b]quinolin-3-yl)-3-nitrobenzamide |
| SMILES | CCn1nc(NC(=O)c2cccc([N+](=O)[O-])c2)c2cc3ccccc3nc21 |
| InChI | InChI=1S/C19H15N5O3/c1-2-23-18-15(11-12-6-3-4-9-16(12)20-18)17(22-23)21-19(25)13-7-5-8-14(10-13)24(26)27/h3-11H,2H2,1H3,(H,21,22,25) |
| InChIKey | JUFRVBSIFRFBDB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|