C9H8ClN3O — CID 171012540
2,5-diamino-3-(2-chloroacetyl)benzonitrile (PubChem CID 171012540) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 2,5-diamino-3-(2-chloroacetyl)benzonitrile.
| Compound Name | 2,5-diamino-3-(2-chloroacetyl)benzonitrile |
|---|---|
| PubChem CID | 171012540 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2,5-diamino-3-(2-chloroacetyl)benzonitrile |
| SMILES | N#Cc1cc(N)cc(C(=O)CCl)c1N |
| InChI | InChI=1S/C9H8ClN3O/c10-3-8(14)7-2-6(12)1-5(4-11)9(7)13/h1-2H,3,12-13H2 |
| InChIKey | PQEJZOBRWRWING-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|