C8H6Cl2N2 — CID 171012671
5-(aminomethyl)-2,4-dichlorobenzonitrile (PubChem CID 171012671) has the molecular formula C8H6Cl2N2 and a molecular weight of 201.06 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dichlorobenzonitrile.
| Compound Name | 5-(aminomethyl)-2,4-dichlorobenzonitrile |
|---|---|
| PubChem CID | 171012671 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 5-(aminomethyl)-2,4-dichlorobenzonitrile |
| SMILES | N#Cc1cc(CN)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2N2/c9-7-2-8(10)6(4-12)1-5(7)3-11/h1-2H,3,11H2 |
| InChIKey | COJNMEWSSISSJX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |