C8H6BrCl2NO — CID 171013966
1-(4-amino-2,5-dichlorophenyl)-2-bromoethanone (PubChem CID 171013966) has the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. Its IUPAC name is 1-(4-amino-2,5-dichlorophenyl)-2-bromoethanone.
| Compound Name | 1-(4-amino-2,5-dichlorophenyl)-2-bromoethanone |
|---|---|
| PubChem CID | 171013966 |
| Molecular Formula | C8H6BrCl2NO |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 1-(4-amino-2,5-dichlorophenyl)-2-bromoethanone |
| SMILES | Nc1cc(Cl)c(C(=O)CBr)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2NO/c9-3-8(13)4-1-6(11)7(12)2-5(4)10/h1-2H,3,12H2 |
| InChIKey | RBPXZTMWQDUKFD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|