C7H6Br2N2O2 — CID 171015045
(2,4-dibromo-3-nitrophenyl)methanamine (PubChem CID 171015045) has the molecular formula C7H6Br2N2O2 and a molecular weight of 309.95 g/mol. Its IUPAC name is (2,4-dibromo-3-nitrophenyl)methanamine.
| Compound Name | (2,4-dibromo-3-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 171015045 |
| Molecular Formula | C7H6Br2N2O2 |
| Molecular Weight | 309.95 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | (2,4-dibromo-3-nitrophenyl)methanamine |
| SMILES | NCc1ccc(Br)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C7H6Br2N2O2/c8-5-2-1-4(3-10)6(9)7(5)11(12)13/h1-2H,3,10H2 |
| InChIKey | NTPCUYNXJQKILY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.95 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|