C11H10ClNO — CID 171015290
2-(2-chloroacetyl)-3,5-dimethylbenzonitrile (PubChem CID 171015290) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is 2-(2-chloroacetyl)-3,5-dimethylbenzonitrile.
| Compound Name | 2-(2-chloroacetyl)-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 171015290 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(2-chloroacetyl)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C)c(C(=O)CCl)c(C#N)c1 |
| InChI | InChI=1S/C11H10ClNO/c1-7-3-8(2)11(10(14)5-12)9(4-7)6-13/h3-4H,5H2,1-2H3 |
| InChIKey | ZPXQIKFZPFZRPI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|