C12H15BrO2 — CID 171017296
methyl 2-[2-(bromomethyl)-4,5-dimethylphenyl]acetate (PubChem CID 171017296) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is methyl 2-[2-(bromomethyl)-4,5-dimethylphenyl]acetate.
| Compound Name | methyl 2-[2-(bromomethyl)-4,5-dimethylphenyl]acetate |
|---|---|
| PubChem CID | 171017296 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | methyl 2-[2-(bromomethyl)-4,5-dimethylphenyl]acetate |
| SMILES | COC(=O)Cc1cc(C)c(C)cc1CBr |
| InChI | InChI=1S/C12H15BrO2/c1-8-4-10(6-12(14)15-3)11(7-13)5-9(8)2/h4-5H,6-7H2,1-3H3 |
| InChIKey | VLMMFHPBVYLYEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|