C12H11F4N5O2 — CID 17102661
2,3,5,6-tetrafluoro-4-methoxy-N-(2-propyltetrazol-5-yl)benzamide (PubChem CID 17102661) has the molecular formula C12H11F4N5O2 and a molecular weight of 333.25 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-(2-propyltetrazol-5-yl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(2-propyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 17102661 |
| Molecular Formula | C12H11F4N5O2 |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-(2-propyltetrazol-5-yl)benzamide |
| SMILES | CCCn1nnc(NC(=O)c2c(F)c(F)c(OC)c(F)c2F)n1 |
| InChI | InChI=1S/C12H11F4N5O2/c1-3-4-21-19-12(18-20-21)17-11(22)5-6(13)8(15)10(23-2)9(16)7(5)14/h3-4H2,1-2H3,(H,17,19,22) |
| InChIKey | DJVYQIXZEQTYPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|