C10H7F5N2 — CID 171029134
2-[5-(difluoromethyl)-6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 171029134) has the molecular formula C10H7F5N2 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(difluoromethyl)-6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 171029134 |
| Molecular Formula | C10H7F5N2 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-[5-(difluoromethyl)-6-methyl-4-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | Cc1nc(CC#N)cc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C10H7F5N2/c1-5-8(9(11)12)7(10(13,14)15)4-6(17-5)2-3-16/h4,9H,2H2,1H3 |
| InChIKey | PIOWJTYEONZYRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |