C10H9ClF3NO2 — CID 171029636
ethyl 2-[3-chloro-6-(difluoromethyl)-5-fluoro-2-pyridinyl]acetate (PubChem CID 171029636) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is ethyl 2-[3-chloro-6-(difluoromethyl)-5-fluoro-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-chloro-6-(difluoromethyl)-5-fluoro-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171029636 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | ethyl 2-[3-chloro-6-(difluoromethyl)-5-fluoro-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(C(F)F)c(F)cc1Cl |
| InChI | InChI=1S/C10H9ClF3NO2/c1-2-17-8(16)4-7-5(11)3-6(12)9(15-7)10(13)14/h3,10H,2,4H2,1H3 |
| InChIKey | KPHQJEYJDSDILH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |