methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate

C10H7ClN2O4 — CID 171029961

IUPACmethyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate
SMILESCOC(=O)Cc1cc(Cl)cc([N+](=O)[O-])c1C#N
InChIInChI=1S/C10H7ClN2O4/c1-17-10(14)3-6-2-7(11)4-9(13(15)16)8(6)5-12/h2,4H,3H2,1H3
InChIKeyHDBIZMPCGFCIFY-UHFFFAOYSA-N
MW254.63 g/mol
LogP1.84
Rot. Bonds3

About methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate

methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate (PubChem CID 171029961) has the molecular formula C10H7ClN2O4 and a molecular weight of 254.63 g/mol. Its IUPAC name is methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate.

Molecular Properties

Compound Namemethyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate
PubChem CID171029961
Molecular FormulaC10H7ClN2O4
Molecular Weight254.63 g/mol
Exact Mass254.01
IUPAC Namemethyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate
SMILESCOC(=O)Cc1cc(Cl)cc([N+](=O)[O-])c1C#N
InChIInChI=1S/C10H7ClN2O4/c1-17-10(14)3-6-2-7(11)4-9(13(15)16)8(6)5-12/h2,4H,3H2,1H3
InChIKeyHDBIZMPCGFCIFY-UHFFFAOYSA-N
XLogP1.84
TPSA93.23 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.63
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate?
The IUPAC name of methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate (CID 171029961) is methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate.
What is the SMILES notation for methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate?
The canonical SMILES for methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate is COC(=O)Cc1cc(Cl)cc([N+](=O)[O-])c1C#N.
What is the InChIKey of methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate?
The InChIKey is HDBIZMPCGFCIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2O4/c1-17-10(14)3-6-2-7(11)4-9(13(15)16)8(6)5-12/h2,4H,3H2,1H3.
What are the key properties of methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate?
methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate has a molecular weight of 254.63 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-chloro-2-cyano-3-nitrophenyl)acetate is sourced from PubChem (CID 171029961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).