C9H7Br2ClO2 — CID 171033937
methyl 2-(2,5-dibromo-3-chlorophenyl)acetate (PubChem CID 171033937) has the molecular formula C9H7Br2ClO2 and a molecular weight of 342.41 g/mol. Its IUPAC name is methyl 2-(2,5-dibromo-3-chlorophenyl)acetate.
| Compound Name | methyl 2-(2,5-dibromo-3-chlorophenyl)acetate |
|---|---|
| PubChem CID | 171033937 |
| Molecular Formula | C9H7Br2ClO2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 339.85 |
| IUPAC Name | methyl 2-(2,5-dibromo-3-chlorophenyl)acetate |
| SMILES | COC(=O)Cc1cc(Br)cc(Cl)c1Br |
| InChI | InChI=1S/C9H7Br2ClO2/c1-14-8(13)3-5-2-6(10)4-7(12)9(5)11/h2,4H,3H2,1H3 |
| InChIKey | DDBIQZXAQNIETN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|