About 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid
2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid (PubChem CID 171034129) has the molecular formula C17H15F5N2O2S
and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid.
Molecular Properties
| Compound Name | 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid |
| PubChem CID | 171034129 |
| Molecular Formula | C17H15F5N2O2S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(F)(F)(F)(F)F)ccc1NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H15F5N2O2S/c18-27(19,20,21,22)12-5-6-16(14(9-12)17(25)26)23-8-7-11-10-24-15-4-2-1-3-13(11)15/h1-6,9-10,23-24H,7-8H2,(H,25,26) |
| InChIKey | LSYKAZDUIZMLHK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid?
The IUPAC name of 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid (CID 171034129) is 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid.
What is the SMILES notation for 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid?
The canonical SMILES for 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid is O=C(O)c1cc(S(F)(F)(F)(F)F)ccc1NCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid?
The InChIKey is LSYKAZDUIZMLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F5N2O2S/c18-27(19,20,21,22)12-5-6-16(14(9-12)17(25)26)23-8-7-11-10-24-15-4-2-1-3-13(11)15/h1-6,9-10,23-24H,7-8H2,(H,25,26).
What are the key properties of 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid?
2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid has a molecular weight of 406.38 g/mol, XLogP of 6.18, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1H-indol-3-yl)ethylamino]-5-(pentafluoro-λ6-sulfanyl)benzoic acid is sourced from PubChem (CID 171034129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).