About 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid
2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid (PubChem CID 171034154) has the molecular formula C19H15Cl2F3N2O2
and a molecular weight of 431.24 g/mol. Its IUPAC name is 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid |
| PubChem CID | 171034154 |
| Molecular Formula | C19H15Cl2F3N2O2 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid |
| SMILES | Cc1[nH]c2c(Cl)c(Cl)ccc2c1CCNc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C19H15Cl2F3N2O2/c1-9-11(12-3-4-14(20)16(21)17(12)26-9)6-7-25-15-5-2-10(19(22,23)24)8-13(15)18(27)28/h2-5,8,25-26H,6-7H2,1H3,(H,27,28) |
| InChIKey | BUZSDCPTUJDODA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid?
The IUPAC name of 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid (CID 171034154) is 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid?
The canonical SMILES for 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid is Cc1[nH]c2c(Cl)c(Cl)ccc2c1CCNc1ccc(C(F)(F)F)cc1C(=O)O.
What is the InChIKey of 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid?
The InChIKey is BUZSDCPTUJDODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2F3N2O2/c1-9-11(12-3-4-14(20)16(21)17(12)26-9)6-7-25-15-5-2-10(19(22,23)24)8-13(15)18(27)28/h2-5,8,25-26H,6-7H2,1H3,(H,27,28).
What are the key properties of 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid?
2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid has a molecular weight of 431.24 g/mol, XLogP of 6.15, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 171034154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).