C22H22ClN7O — CID 171034292
[5-chloro-1-ethyl-6-(tetrazolidin-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol (PubChem CID 171034292) has the molecular formula C22H22ClN7O and a molecular weight of 435.92 g/mol. Its IUPAC name is [5-chloro-1-ethyl-6-(tetrazolidin-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol.
| Compound Name | [5-chloro-1-ethyl-6-(tetrazolidin-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 171034292 |
| Molecular Formula | C22H22ClN7O |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [5-chloro-1-ethyl-6-(tetrazolidin-5-yl)imidazo[4,5-b]pyridin-2-yl]-diphenylmethanol |
| SMILES | CCn1c(C(O)(c2ccccc2)c2ccccc2)nc2nc(Cl)c(C3NNNN3)cc21 |
| InChI | InChI=1S/C22H22ClN7O/c1-2-30-17-13-16(19-26-28-29-27-19)18(23)24-20(17)25-21(30)22(31,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,19,26-29,31H,2H2,1H3 |
| InChIKey | VRMRMEVLOXQWSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|