C24H28BaF6O4 — CID 171034699
barium(2+);bis(2,2,2-trifluoro-1-[(4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethanolate) (PubChem CID 171034699) has the molecular formula C24H28BaF6O4 and a molecular weight of 631.80 g/mol. Its IUPAC name is barium(2+);bis(2,2,2-trifluoro-1-[(4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethanolate).
| Compound Name | barium(2+);bis(2,2,2-trifluoro-1-[(4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethanolate) |
|---|---|
| PubChem CID | 171034699 |
| Molecular Formula | C24H28BaF6O4 |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | barium(2+);bis(2,2,2-trifluoro-1-[(4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethanolate) |
| SMILES | CC1(C)C2CC[C@@]1(C)C(=O)C2=C([O-])C(F)(F)F.CC1(C)C2CC[C@@]1(C)C(=O)C2=C([O-])C(F)(F)F.[Ba+2] |
| InChI | InChI=1S/2C12H15F3O2.Ba/c2*1-10(2)6-4-5-11(10,3)8(16)7(6)9(17)12(13,14)15;/h2*6,17H,4-5H2,1-3H3;/q;;+2/p-2/t2*6?,11-;/m00./s1 |
| InChIKey | LGSBEDXATSQGDM-CETLNCEASA-L |
| XLogP | 4.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|