C8H9NO — CID 171035109
1,2,6,7-tetrahydrocyclopenta[c]pyridin-5-one (PubChem CID 171035109) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,2,6,7-tetrahydrocyclopenta[c]pyridin-5-one.
| Compound Name | 1,2,6,7-tetrahydrocyclopenta[c]pyridin-5-one |
|---|---|
| PubChem CID | 171035109 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 1,2,6,7-tetrahydrocyclopenta[c]pyridin-5-one |
| SMILES | O=C1CCC2=C1C=CNC2 |
| InChI | InChI=1S/C8H9NO/c10-8-2-1-6-5-9-4-3-7(6)8/h3-4,9H,1-2,5H2 |
| InChIKey | UOKAEBACXHZIDV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |