C6H10N4 — CID 171035213
6-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 171035213) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 6-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 6-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 171035213 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 6-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | CC1Cn2ncnc2CN1 |
| InChI | InChI=1S/C6H10N4/c1-5-3-10-6(2-7-5)8-4-9-10/h4-5,7H,2-3H2,1H3 |
| InChIKey | VPQJJGACJAYODU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |