About ethylsulfinylmethanimine
ethylsulfinylmethanimine (PubChem CID 171035287) has the molecular formula C3H7NOS
and a molecular weight of 105.16 g/mol. Its IUPAC name is ethylsulfinylmethanimine.
Molecular Properties
| Compound Name | ethylsulfinylmethanimine |
| PubChem CID | 171035287 |
| Molecular Formula | C3H7NOS |
| Molecular Weight | 105.16 g/mol |
| Exact Mass | 105.02 |
| IUPAC Name | ethylsulfinylmethanimine |
| SMILES | [H]/N=C/S(=O)CC |
| InChI | InChI=1S/C3H7NOS/c1-2-6(5)3-4/h3-4H,2H2,1H3/b4-3+ |
| InChIKey | BXFXTCBVMZAWTK-ONEGZZNKSA-N |
| XLogP | 0.36 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfinylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfinylmethanimine?
The IUPAC name of ethylsulfinylmethanimine (CID 171035287) is ethylsulfinylmethanimine.
What is the SMILES notation for ethylsulfinylmethanimine?
The canonical SMILES for ethylsulfinylmethanimine is [H]/N=C/S(=O)CC.
What is the InChIKey of ethylsulfinylmethanimine?
The InChIKey is BXFXTCBVMZAWTK-ONEGZZNKSA-N. The full InChI is InChI=1S/C3H7NOS/c1-2-6(5)3-4/h3-4H,2H2,1H3/b4-3+.
What are the key properties of ethylsulfinylmethanimine?
ethylsulfinylmethanimine has a molecular weight of 105.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfinylmethanimine is sourced from PubChem (CID 171035287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).