About (4R)-1,6-diazaspiro[3.3]heptan-7-one
(4R)-1,6-diazaspiro[3.3]heptan-7-one (PubChem CID 171035437) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is (4R)-1,6-diazaspiro[3.3]heptan-7-one.
Molecular Properties
| Compound Name | (4R)-1,6-diazaspiro[3.3]heptan-7-one |
| PubChem CID | 171035437 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | (4R)-1,6-diazaspiro[3.3]heptan-7-one |
| SMILES | O=C1NC[C@]12CCN2 |
| InChI | InChI=1S/C5H8N2O/c8-4-5(3-6-4)1-2-7-5/h7H,1-3H2,(H,6,8)/t5-/m1/s1 |
| InChIKey | WGTJNPSBFKFHHL-RXMQYKEDSA-N |
| XLogP | -1.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-1,6-diazaspiro[3.3]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,6-diazaspiro[3.3]heptan-7-one?
The IUPAC name of (4R)-1,6-diazaspiro[3.3]heptan-7-one (CID 171035437) is (4R)-1,6-diazaspiro[3.3]heptan-7-one.
What is the SMILES notation for (4R)-1,6-diazaspiro[3.3]heptan-7-one?
The canonical SMILES for (4R)-1,6-diazaspiro[3.3]heptan-7-one is O=C1NC[C@]12CCN2.
What is the InChIKey of (4R)-1,6-diazaspiro[3.3]heptan-7-one?
The InChIKey is WGTJNPSBFKFHHL-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H8N2O/c8-4-5(3-6-4)1-2-7-5/h7H,1-3H2,(H,6,8)/t5-/m1/s1.
What are the key properties of (4R)-1,6-diazaspiro[3.3]heptan-7-one?
(4R)-1,6-diazaspiro[3.3]heptan-7-one has a molecular weight of 112.13 g/mol, XLogP of -1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,6-diazaspiro[3.3]heptan-7-one is sourced from PubChem (CID 171035437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).