About Ferrocene,1,1'-bis(methoxycarbonyl)-
Ferrocene,1,1'-bis(methoxycarbonyl)- (PubChem CID 171036319) has the molecular formula C14H14FeO4
and a molecular weight of 302.11 g/mol.
Molecular Properties
| Compound Name | Ferrocene,1,1'-bis(methoxycarbonyl)- |
| PubChem CID | 171036319 |
| Molecular Formula | C14H14FeO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | — |
| SMILES | COC(=O)[C]1[CH][CH][CH][CH]1.COC(=O)[C]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/2C7H7O2.Fe/c2*1-9-7(8)6-4-2-3-5-6;/h2*2-5H,1H3; |
| InChIKey | XYXYRORHDADYHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Ferrocene,1,1'-bis(methoxycarbonyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ferrocene,1,1'-bis(methoxycarbonyl)-?
The IUPAC name of Ferrocene,1,1'-bis(methoxycarbonyl)- (CID 171036319) is not available.
What is the SMILES notation for Ferrocene,1,1'-bis(methoxycarbonyl)-?
The canonical SMILES for Ferrocene,1,1'-bis(methoxycarbonyl)- is COC(=O)[C]1[CH][CH][CH][CH]1.COC(=O)[C]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of Ferrocene,1,1'-bis(methoxycarbonyl)-?
The InChIKey is XYXYRORHDADYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7O2.Fe/c2*1-9-7(8)6-4-2-3-5-6;/h2*2-5H,1H3;.
What are the key properties of Ferrocene,1,1'-bis(methoxycarbonyl)-?
Ferrocene,1,1'-bis(methoxycarbonyl)- has a molecular weight of 302.11 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ferrocene,1,1'-bis(methoxycarbonyl)- is sourced from PubChem (CID 171036319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).