C11H15NOS — CID 171036663
3-ethoxy-2,6-dimethyl-2H-1,3-benzothiazole (PubChem CID 171036663) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 3-ethoxy-2,6-dimethyl-2H-1,3-benzothiazole.
| Compound Name | 3-ethoxy-2,6-dimethyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 171036663 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 3-ethoxy-2,6-dimethyl-2H-1,3-benzothiazole |
| SMILES | CCON1c2ccc(C)cc2SC1C |
| InChI | InChI=1S/C11H15NOS/c1-4-13-12-9(3)14-11-7-8(2)5-6-10(11)12/h5-7,9H,4H2,1-3H3 |
| InChIKey | QPKIKJGUGGUYIU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |