C20H32 — CID 171037428
(3Z,8Z)-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),3,8-triene (PubChem CID 171037428) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (3Z,8Z)-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),3,8-triene.
| Compound Name | (3Z,8Z)-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),3,8-triene |
|---|---|
| PubChem CID | 171037428 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (3Z,8Z)-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),3,8-triene |
| SMILES | CC1=C2C/C=C(/C)CCC/C(C)=C\CC(CC1)C2(C)C |
| InChI | InChI=1S/C20H32/c1-15-7-6-8-16(2)10-14-19-17(3)11-13-18(12-9-15)20(19,4)5/h9-10,18H,6-8,11-14H2,1-5H3/b15-9-,16-10- |
| InChIKey | PCIXTRZRJQICOW-VULZFCBJSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|