About 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile
2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile (PubChem CID 171037465) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile |
| PubChem CID | 171037465 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile |
| SMILES | N#CC=C1C=CC(O)C(O)C1O |
| InChI | InChI=1S/C8H9NO3/c9-4-3-5-1-2-6(10)8(12)7(5)11/h1-3,6-8,10-12H |
| InChIKey | SIKDHUUZRZDYPO-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile?
The IUPAC name of 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile (CID 171037465) is 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile.
What is the SMILES notation for 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile?
The canonical SMILES for 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile is N#CC=C1C=CC(O)C(O)C1O.
What is the InChIKey of 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile?
The InChIKey is SIKDHUUZRZDYPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c9-4-3-5-1-2-6(10)8(12)7(5)11/h1-3,6-8,10-12H.
What are the key properties of 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile?
2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile has a molecular weight of 167.16 g/mol, XLogP of -0.91, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6-trihydroxycyclohex-2-en-1-ylidene)acetonitrile is sourced from PubChem (CID 171037465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).