C47H32Br2N4 — CID 171037584
4-[5,11-dibromo-8-[4-(N-phenylanilino)phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]-N,N-diphenylaniline (PubChem CID 171037584) has the molecular formula C47H32Br2N4 and a molecular weight of 812.61 g/mol. Its IUPAC name is 4-[5,11-dibromo-8-[4-(N-phenylanilino)phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5,11-dibromo-8-[4-(N-phenylanilino)phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 171037584 |
| Molecular Formula | C47H32Br2N4 |
| Molecular Weight | 812.61 g/mol |
| Exact Mass | 810.10 |
| IUPAC Name | 4-[5,11-dibromo-8-[4-(N-phenylanilino)phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]-N,N-diphenylaniline |
| SMILES | Brc1cnc2c(c1)C(c1ccc(N(c3ccccc3)c3ccccc3)cc1)(c1ccc(N(c3ccccc3)c3ccccc3)cc1)c1cc(Br)cnc1-2 |
| InChI | InChI=1S/C47H32Br2N4/c48-35-29-43-45(50-31-35)46-44(30-36(49)32-51-46)47(43,33-21-25-41(26-22-33)52(37-13-5-1-6-14-37)38-15-7-2-8-16-38)34-23-27-42(28-24-34)53(39-17-9-3-10-18-39)40-19-11-4-12-20-40/h1-32H |
| InChIKey | LJRYWRURSGIWRH-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.61 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |