C19H13ClO6 — CID 171038297
10-(3-chloro-4-hydroxyphenyl)-6-hydroxy-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione (PubChem CID 171038297) has the molecular formula C19H13ClO6 and a molecular weight of 372.76 g/mol. Its IUPAC name is 10-(3-chloro-4-hydroxyphenyl)-6-hydroxy-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione.
| Compound Name | 10-(3-chloro-4-hydroxyphenyl)-6-hydroxy-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 171038297 |
| Molecular Formula | C19H13ClO6 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 10-(3-chloro-4-hydroxyphenyl)-6-hydroxy-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
| SMILES | Cc1cc(=O)oc2c3c(c(O)cc12)OC(=O)CC3c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C19H13ClO6/c1-8-4-15(23)25-18-10(8)6-14(22)19-17(18)11(7-16(24)26-19)9-2-3-13(21)12(20)5-9/h2-6,11,21-22H,7H2,1H3 |
| InChIKey | WMDCFNUKIQFGBW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|