C29H30N2O3 — CID 171038383
7-ethoxy-10,12,12-trimethyl-2-(4-phenylmethoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-4-one (PubChem CID 171038383) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 7-ethoxy-10,12,12-trimethyl-2-(4-phenylmethoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-4-one.
| Compound Name | 7-ethoxy-10,12,12-trimethyl-2-(4-phenylmethoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-4-one |
|---|---|
| PubChem CID | 171038383 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 7-ethoxy-10,12,12-trimethyl-2-(4-phenylmethoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraen-4-one |
| SMILES | CCOc1cc2c3c(c1)C(C)=CC(C)(C)N3C(c1ccc(OCc3ccccc3)cc1)NC2=O |
| InChI | InChI=1S/C29H30N2O3/c1-5-33-23-15-24-19(2)17-29(3,4)31-26(24)25(16-23)28(32)30-27(31)21-11-13-22(14-12-21)34-18-20-9-7-6-8-10-20/h6-17,27H,5,18H2,1-4H3,(H,30,32) |
| InChIKey | KYGMVFXHRUHQJE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|