About dichloronickel(2+);bis(triphenylphosphane)
dichloronickel(2+);bis(triphenylphosphane) (PubChem CID 171039968) has the molecular formula C36H30Cl2NiP2+2
and a molecular weight of 654.18 g/mol. Its IUPAC name is dichloronickel(2+);bis(triphenylphosphane).
Molecular Properties
| Compound Name | dichloronickel(2+);bis(triphenylphosphane) |
| PubChem CID | 171039968 |
| Molecular Formula | C36H30Cl2NiP2+2 |
| Molecular Weight | 654.18 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | dichloronickel(2+);bis(triphenylphosphane) |
| SMILES | Cl[Ni+2]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+4/p-2 |
| InChIKey | VHQPRJDILRYZBG-UHFFFAOYSA-L |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 654.18 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel(2+);bis(triphenylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel(2+);bis(triphenylphosphane)?
The IUPAC name of dichloronickel(2+);bis(triphenylphosphane) (CID 171039968) is dichloronickel(2+);bis(triphenylphosphane).
What is the SMILES notation for dichloronickel(2+);bis(triphenylphosphane)?
The canonical SMILES for dichloronickel(2+);bis(triphenylphosphane) is Cl[Ni+2]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichloronickel(2+);bis(triphenylphosphane)?
The InChIKey is VHQPRJDILRYZBG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+4/p-2.
What are the key properties of dichloronickel(2+);bis(triphenylphosphane)?
dichloronickel(2+);bis(triphenylphosphane) has a molecular weight of 654.18 g/mol, XLogP of 8.27, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel(2+);bis(triphenylphosphane) is sourced from PubChem (CID 171039968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).