C41H69N5O8 — CID 171040102
(4S)-N-[3-(carbamoylamino)propyl]-6-cyclohexyl-4-hydroxy-5-[2-[1-[4-(methoxymethoxy)piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]oxyhexanoylamino]-2-propan-2-ylhexanamide (PubChem CID 171040102) has the molecular formula C41H69N5O8 and a molecular weight of 760.03 g/mol. Its IUPAC name is (4S)-N-[3-(carbamoylamino)propyl]-6-cyclohexyl-4-hydroxy-5-[2-[1-[4-(methoxymethoxy)piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]oxyhexanoylamino]-2-propan-2-ylhexanamide.
| Compound Name | (4S)-N-[3-(carbamoylamino)propyl]-6-cyclohexyl-4-hydroxy-5-[2-[1-[4-(methoxymethoxy)piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]oxyhexanoylamino]-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 171040102 |
| Molecular Formula | C41H69N5O8 |
| Molecular Weight | 760.03 g/mol |
| Exact Mass | 759.51 |
| IUPAC Name | (4S)-N-[3-(carbamoylamino)propyl]-6-cyclohexyl-4-hydroxy-5-[2-[1-[4-(methoxymethoxy)piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]oxyhexanoylamino]-2-propan-2-ylhexanamide |
| SMILES | CCCCC(OC(Cc1ccccc1)C(=O)N1CCC(OCOC)CC1)C(=O)NC(CC1CCCCC1)[C@@H](O)CC(C(=O)NCCCNC(N)=O)C(C)C |
| InChI | InChI=1S/C41H69N5O8/c1-5-6-18-36(54-37(26-31-16-11-8-12-17-31)40(50)46-23-19-32(20-24-46)53-28-52-4)39(49)45-34(25-30-14-9-7-10-15-30)35(47)27-33(29(2)3)38(48)43-21-13-22-44-41(42)51/h8,11-12,16-17,29-30,32-37,47H,5-7,9-10,13-15,18-28H2,1-4H3,(H,43,48)(H,45,49)(H3,42,44,51)/t33?,34?,35-,36?,37?/m0/s1 |
| InChIKey | OTOQNEUJTXSRLA-DMMOQJRJSA-N |
| XLogP | 4.44 |
| TPSA | 181.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.03 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|