About zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide)
zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) (PubChem CID 171040843) has the molecular formula C18H16N6O6S2Zn
and a molecular weight of 541.89 g/mol. Its IUPAC name is zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide).
Molecular Properties
| Compound Name | zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) |
| PubChem CID | 171040843 |
| Molecular Formula | C18H16N6O6S2Zn |
| Molecular Weight | 541.89 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) |
| SMILES | Nc1ccc(S(=O)(=O)[N-]c2ccon2)cc1.Nc1ccc(S(=O)(=O)[N-]c2ccon2)cc1.[Zn+2] |
| InChI | InChI=1S/2C9H8N3O3S.Zn/c2*10-7-1-3-8(4-2-7)16(13,14)12-9-5-6-15-11-9;/h2*1-6H,10H2;/q2*-1;+2 |
| InChIKey | XLFHEWROKWQMAE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 200.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide)?
The IUPAC name of zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) (CID 171040843) is zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide).
What is the SMILES notation for zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide)?
The canonical SMILES for zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) is Nc1ccc(S(=O)(=O)[N-]c2ccon2)cc1.Nc1ccc(S(=O)(=O)[N-]c2ccon2)cc1.[Zn+2].
What is the InChIKey of zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide)?
The InChIKey is XLFHEWROKWQMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8N3O3S.Zn/c2*10-7-1-3-8(4-2-7)16(13,14)12-9-5-6-15-11-9;/h2*1-6H,10H2;/q2*-1;+2.
What are the key properties of zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide)?
zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) has a molecular weight of 541.89 g/mol, XLogP of 3.30, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis((4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide) is sourced from PubChem (CID 171040843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).