About gold(1+);2-methylpropanoate;triphenylphosphanium
gold(1+);2-methylpropanoate;triphenylphosphanium (PubChem CID 171041011) has the molecular formula C22H23AuO2P+
and a molecular weight of 547.37 g/mol. Its IUPAC name is gold(1+);2-methylpropanoate;triphenylphosphanium.
Molecular Properties
| Compound Name | gold(1+);2-methylpropanoate;triphenylphosphanium |
| PubChem CID | 171041011 |
| Molecular Formula | C22H23AuO2P+ |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | gold(1+);2-methylpropanoate;triphenylphosphanium |
| SMILES | CC(C)C(=O)[O-].[Au+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H8O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4(5)6;/h1-15H;3H,1-2H3,(H,5,6);/q;;+1 |
| InChIKey | HPVDBHJQEAJDFN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);2-methylpropanoate;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);2-methylpropanoate;triphenylphosphanium?
The IUPAC name of gold(1+);2-methylpropanoate;triphenylphosphanium (CID 171041011) is gold(1+);2-methylpropanoate;triphenylphosphanium.
What is the SMILES notation for gold(1+);2-methylpropanoate;triphenylphosphanium?
The canonical SMILES for gold(1+);2-methylpropanoate;triphenylphosphanium is CC(C)C(=O)[O-].[Au+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of gold(1+);2-methylpropanoate;triphenylphosphanium?
The InChIKey is HPVDBHJQEAJDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C4H8O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4(5)6;/h1-15H;3H,1-2H3,(H,5,6);/q;;+1.
What are the key properties of gold(1+);2-methylpropanoate;triphenylphosphanium?
gold(1+);2-methylpropanoate;triphenylphosphanium has a molecular weight of 547.37 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);2-methylpropanoate;triphenylphosphanium is sourced from PubChem (CID 171041011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).