About manganese(2+);bis(quinolin-8-olate)
manganese(2+);bis(quinolin-8-olate) (PubChem CID 171041055) has the molecular formula C18H12MnN2O2
and a molecular weight of 343.24 g/mol. Its IUPAC name is manganese(2+);bis(quinolin-8-olate).
Molecular Properties
| Compound Name | manganese(2+);bis(quinolin-8-olate) |
| PubChem CID | 171041055 |
| Molecular Formula | C18H12MnN2O2 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | manganese(2+);bis(quinolin-8-olate) |
| SMILES | [Mn+2].[O-]c1cccc2cccnc12.[O-]c1cccc2cccnc12 |
| InChI | InChI=1S/2C9H7NO.Mn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2 |
| InChIKey | XNUVVHVFAAQPQY-UHFFFAOYSA-L |
| XLogP | 2.61 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze manganese(2+);bis(quinolin-8-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(quinolin-8-olate)?
The IUPAC name of manganese(2+);bis(quinolin-8-olate) (CID 171041055) is manganese(2+);bis(quinolin-8-olate).
What is the SMILES notation for manganese(2+);bis(quinolin-8-olate)?
The canonical SMILES for manganese(2+);bis(quinolin-8-olate) is [Mn+2].[O-]c1cccc2cccnc12.[O-]c1cccc2cccnc12.
What is the InChIKey of manganese(2+);bis(quinolin-8-olate)?
The InChIKey is XNUVVHVFAAQPQY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7NO.Mn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2.
What are the key properties of manganese(2+);bis(quinolin-8-olate)?
manganese(2+);bis(quinolin-8-olate) has a molecular weight of 343.24 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(quinolin-8-olate) is sourced from PubChem (CID 171041055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).