C17H7F19O — CID 171042002
1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)benzene (PubChem CID 171042002) has the molecular formula C17H7F19O and a molecular weight of 588.20 g/mol. Its IUPAC name is 1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)benzene.
| Compound Name | 1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)benzene |
|---|---|
| PubChem CID | 171042002 |
| Molecular Formula | C17H7F19O |
| Molecular Weight | 588.20 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | 1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)benzene |
| SMILES | C=Cc1ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H7F19O/c1-2-7-3-5-8(6-4-7)37-17(35,36)15(30,31)13(26,27)11(22,23)9(18,19)10(20,21)12(24,25)14(28,29)16(32,33)34/h2-6H,1H2 |
| InChIKey | YNKONPKDOAQREQ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.20 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|