C15H8F17NO2S — CID 171042037
N-benzyl-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-2-sulfonamide (PubChem CID 171042037) has the molecular formula C15H8F17NO2S and a molecular weight of 589.27 g/mol. Its IUPAC name is N-benzyl-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-2-sulfonamide.
| Compound Name | N-benzyl-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-2-sulfonamide |
|---|---|
| PubChem CID | 171042037 |
| Molecular Formula | C15H8F17NO2S |
| Molecular Weight | 589.27 g/mol |
| Exact Mass | 589.00 |
| IUPAC Name | N-benzyl-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H8F17NO2S/c16-8(17,10(20,21)12(24,25)14(27,28)29)9(18,19)11(22,23)13(26,15(30,31)32)36(34,35)33-6-7-4-2-1-3-5-7/h1-5,33H,6H2 |
| InChIKey | QJPDUNDLQJIXPO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|