C13H19F11N2O5S2 — CID 171042128
3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate (PubChem CID 171042128) has the molecular formula C13H19F11N2O5S2 and a molecular weight of 556.42 g/mol. Its IUPAC name is 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 171042128 |
| Molecular Formula | C13H19F11N2O5S2 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H19F11N2O5S2/c1-26(2,7-4-8-32(27,28)29)6-3-5-25-33(30,31)13(23,24)11(18,19)9(14,15)10(16,17)12(20,21)22/h25H,3-8H2,1-2H3 |
| InChIKey | DNQQNHMQRHDWLQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|