C19H9Cl2I2NO3 — CID 171042274
CID 171042274 (PubChem CID 171042274) has the molecular formula C19H9Cl2I2NO3 and a molecular weight of 629.95 g/mol.
| Compound Name | CID 171042274 |
|---|---|
| PubChem CID | 171042274 |
| Molecular Formula | C19H9Cl2I2NO3 |
| Molecular Weight | 629.95 g/mol |
| Exact Mass | 628.83 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1)[13c]1[13c][13c](I)[13c][13c](I)[13c]1O |
| InChI | InChI=1S/C19H9Cl2I2NO3/c20-10-1-4-13(5-2-10)27-17-6-3-12(9-15(17)21)24-19(26)14-7-11(22)8-16(23)18(14)25/h1-6,9,25H,(H,24,26)/i7+1,8+1,11+1,14+1,16+1,18+1 |
| InChIKey | IXMFZRZZJMQKKS-QBPDDYRQSA-N |
| XLogP | 6.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|