C26H25FO9S — CID 171042409
(2S,3S,4S,5R,6S)-6-[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171042409) has the molecular formula C26H25FO9S and a molecular weight of 532.54 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171042409 |
| Molecular Formula | C26H25FO9S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1=C(CC(=O)O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c2cc(F)ccc2/C1=C/c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C26H25FO9S/c1-12-17(9-13-3-6-15(7-4-13)37(2)34)16-8-5-14(27)10-19(16)18(12)11-20(28)35-26-23(31)21(29)22(30)24(36-26)25(32)33/h3-10,21-24,26,29-31H,11H2,1-2H3,(H,32,33)/b17-9+/t21-,22-,23+,24-,26+,37?/m0/s1 |
| InChIKey | ZGOXLKUBXKIPQX-XSKSNECTSA-N |
| XLogP | 1.72 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|