C23H27NO8 — CID 171042621
(5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(E,1S,2S)-1-hydroxy-2-methoxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 171042621) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(E,1S,2S)-1-hydroxy-2-methoxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(E,1S,2S)-1-hydroxy-2-methoxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 171042621 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(E,1S,2S)-1-hydroxy-2-methoxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C/[C@H](OC)[C@H](O)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C23H27NO8/c1-5-6-12-15(30-3)16(25)17-13(2)18(26)22(32-17)20(28)23(31-4,24-21(22)29)19(27)14-10-8-7-9-11-14/h6-12,15-16,20,25,28H,5H2,1-4H3,(H,24,29)/b12-6+/t15-,16-,20+,22+,23+/m0/s1 |
| InChIKey | BSXLPZRKEPWAAT-ZMPJLCIYSA-N |
| XLogP | 0.66 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|