C22H35NO3 — CID 171042666
2-[[(5Z,8Z,11Z,14E)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid (PubChem CID 171042666) has the molecular formula C22H35NO3 and a molecular weight of 369.57 g/mol. Its IUPAC name is 2-[[(5Z,8Z,11Z,14E)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid.
| Compound Name | 2-[[(5Z,8Z,11Z,14E)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid |
|---|---|
| PubChem CID | 171042666 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 2-[[(5Z,8Z,11Z,14E)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoyl]amino]acetic acid |
| SMILES | [2H]/C(CCCC(=O)NCC(=O)O)=C(\[2H])C/C([2H])=C(/[2H])C/C([2H])=C(/[2H])C/C([2H])=C(\[2H])CCCCC |
| InChI | InChI=1S/C22H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)23-20-22(25)26/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3,(H,23,24)(H,25,26)/b7-6+,10-9-,13-12-,16-15-/i6D,7D,9D,10D,12D,13D,15D,16D |
| InChIKey | YLEARPUNMCCKMP-VFVYIREFSA-N |
| XLogP | 5.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|