C24H39NaO4- — CID 171042915
Ursodeoxycholic Acid (sodium salt) (PubChem CID 171042915) has the molecular formula C24H39NaO4- and a molecular weight of 414.56 g/mol.
| Compound Name | Ursodeoxycholic Acid (sodium salt) |
|---|---|
| PubChem CID | 171042915 |
| Molecular Formula | C24H39NaO4- |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | — |
| SMILES | C[C@H](CCC(=O)[O-])[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.[Na] |
| InChI | InChI=1S/C24H40O4.Na/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26;/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28);/p-1/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-;/m1./s1 |
| InChIKey | DOVZGADDWOFQEZ-FUXQPCDDSA-M |
| XLogP | 2.76 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |