C21H27N5NaO9S2 — CID 171042989
CID 171042989 (PubChem CID 171042989) has the molecular formula C21H27N5NaO9S2 and a molecular weight of 580.60 g/mol.
| Compound Name | CID 171042989 |
|---|---|
| PubChem CID | 171042989 |
| Molecular Formula | C21H27N5NaO9S2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | — |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](NC(=O)N3CCN(S(C)(=O)=O)C3=O)c3ccccc3)C(=O)N2[C@H]1C(=O)O.O.[Na] |
| InChI | InChI=1S/C21H25N5O8S2.Na.H2O/c1-21(2)14(18(29)30)26-16(28)13(17(26)35-21)22-15(27)12(11-7-5-4-6-8-11)23-19(31)24-9-10-25(20(24)32)36(3,33)34;;/h4-8,12-14,17H,9-10H2,1-3H3,(H,22,27)(H,23,31)(H,29,30);;1H2/t12-,13-,14+,17-;;/m1../s1 |
| InChIKey | YMKWNBCJJHSEEL-SYNJJEHYSA-N |
| XLogP | -1.44 |
| TPSA | 205.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |