About CID 171042989
CID 171042989 (PubChem CID 171042989) has the molecular formula C21H27N5NaO9S2
and a molecular weight of 580.60 g/mol.
Molecular Properties
| Compound Name | CID 171042989 |
| PubChem CID | 171042989 |
| Molecular Formula | C21H27N5NaO9S2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | — |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](NC(=O)N3CCN(S(C)(=O)=O)C3=O)c3ccccc3)C(=O)N2[C@H]1C(=O)O.O.[Na] |
| InChI | InChI=1S/C21H25N5O8S2.Na.H2O/c1-21(2)14(18(29)30)26-16(28)13(17(26)35-21)22-15(27)12(11-7-5-4-6-8-11)23-19(31)24-9-10-25(20(24)32)36(3,33)34;;/h4-8,12-14,17H,9-10H2,1-3H3,(H,22,27)(H,23,31)(H,29,30);;1H2/t12-,13-,14+,17-;;/m1../s1 |
| InChIKey | YMKWNBCJJHSEEL-SYNJJEHYSA-N |
| XLogP | -1.44 |
| TPSA | 205.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 171042989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171042989?
The IUPAC name of CID 171042989 (CID 171042989) is not available.
What is the SMILES notation for CID 171042989?
The canonical SMILES for CID 171042989 is CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](NC(=O)N3CCN(S(C)(=O)=O)C3=O)c3ccccc3)C(=O)N2[C@H]1C(=O)O.O.[Na].
What is the InChIKey of CID 171042989?
The InChIKey is YMKWNBCJJHSEEL-SYNJJEHYSA-N. The full InChI is InChI=1S/C21H25N5O8S2.Na.H2O/c1-21(2)14(18(29)30)26-16(28)13(17(26)35-21)22-15(27)12(11-7-5-4-6-8-11)23-19(31)24-9-10-25(20(24)32)36(3,33)34;;/h4-8,12-14,17H,9-10H2,1-3H3,(H,22,27)(H,23,31)(H,29,30);;1H2/t12-,13-,14+,17-;;/m1../s1.
What are the key properties of CID 171042989?
CID 171042989 has a molecular weight of 580.60 g/mol, XLogP of -1.44, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171042989 is sourced from PubChem (CID 171042989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).