C40H30IrN5 — CID 171043159
bis(10H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+);2-methyl-11-phenyl-10-azatetracyclo[5.4.1.02,5.03,8]dodeca-7(12),8,10-triene (PubChem CID 171043159) has the molecular formula C40H30IrN5 and a molecular weight of 772.93 g/mol. Its IUPAC name is bis(10H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+);2-methyl-11-phenyl-10-azatetracyclo[5.4.1.02,5.03,8]dodeca-7(12),8,10-triene.
| Compound Name | bis(10H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+);2-methyl-11-phenyl-10-azatetracyclo[5.4.1.02,5.03,8]dodeca-7(12),8,10-triene |
|---|---|
| PubChem CID | 171043159 |
| Molecular Formula | C40H30IrN5 |
| Molecular Weight | 772.93 g/mol |
| Exact Mass | 773.21 |
| IUPAC Name | bis(10H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+);2-methyl-11-phenyl-10-azatetracyclo[5.4.1.02,5.03,8]dodeca-7(12),8,10-triene |
| SMILES | CC12C3CC4=CC1C(c1[c-]cccc1)=NC=C4C2C3.[Ir+3].[c-]1cccc2ccn3ccnc3c12.[c-]1cccc2ccn3ccnc3c12 |
| InChI | InChI=1S/C18H16N.2C11H7N2.Ir/c1-18-13-7-12-8-16(18)17(11-5-3-2-4-6-11)19-10-14(12)15(18)9-13;2*1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;/h2-5,8,10,13,15-16H,7,9H2,1H3;2*1-3,5-8H;/q3*-1;+3 |
| InChIKey | XGVLAPJBIYDCFK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 46.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.93 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|