About CID 171043592
CID 171043592 (PubChem CID 171043592) has the molecular formula C46H45IrNO2-2
and a molecular weight of 836.09 g/mol.
Molecular Properties
| Compound Name | CID 171043592 |
| PubChem CID | 171043592 |
| Molecular Formula | C46H45IrNO2-2 |
| Molecular Weight | 836.09 g/mol |
| Exact Mass | 836.31 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccc2cc1C1[N-]C=Cc3ccc(cc31)-c1ccccc1-c1cccc(c1)-c1cccc-2c1 |
| InChI | InChI=1S/C33H21N.C13H24O2.Ir/c1-2-13-31-28-15-14-22-16-17-34-33(32(22)21-28)29-11-5-9-26(20-29)24-7-3-6-23(18-24)25-8-4-10-27(19-25)30(31)12-1;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-10,12-21,33H;9-11,14H,5-8H2,1-4H3;/q-2;;/b;12-9-; |
| InChIKey | PPVUSSWOTFZJQQ-DZTQYQPZSA-N |
| XLogP | 12.78 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 836.09 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171043592 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171043592?
The IUPAC name of CID 171043592 (CID 171043592) is not available.
What is the SMILES notation for CID 171043592?
The canonical SMILES for CID 171043592 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccc2cc1C1[N-]C=Cc3ccc(cc31)-c1ccccc1-c1cccc(c1)-c1cccc-2c1.
What is the InChIKey of CID 171043592?
The InChIKey is PPVUSSWOTFZJQQ-DZTQYQPZSA-N. The full InChI is InChI=1S/C33H21N.C13H24O2.Ir/c1-2-13-31-28-15-14-22-16-17-34-33(32(22)21-28)29-11-5-9-26(20-29)24-7-3-6-23(18-24)25-8-4-10-27(19-25)30(31)12-1;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-10,12-21,33H;9-11,14H,5-8H2,1-4H3;/q-2;;/b;12-9-;.
What are the key properties of CID 171043592?
CID 171043592 has a molecular weight of 836.09 g/mol, XLogP of 12.78, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171043592 is sourced from PubChem (CID 171043592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).