C44H26O — CID 171044871
12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 171044871) has the molecular formula C44H26O and a molecular weight of 575.72 g/mol. Its IUPAC name is 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 171044871 |
| Molecular Formula | C44H26O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 12-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-1-yl]phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4c(-c5cccc(-c6ccc7c8c(cccc68)-c6ccccc6O7)c5)ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C44H26O/c1-2-8-27(9-3-1)32-20-16-28-19-23-39-33(21-17-29-18-22-38(32)42(28)43(29)39)30-10-6-11-31(26-30)34-24-25-41-44-36(34)13-7-14-37(44)35-12-4-5-15-40(35)45-41/h1-26H/i1D,2D,3D,8D,9D |
| InChIKey | DUCLEYIBFBWTBC-NWCULCSXSA-N |
| XLogP | 12.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|