About CID 171046468
CID 171046468 (PubChem CID 171046468) has the molecular formula C86H68N4O2Pt-2
and a molecular weight of 1395.66 g/mol.
Molecular Properties
| Compound Name | CID 171046468 |
| PubChem CID | 171046468 |
| Molecular Formula | C86H68N4O2Pt-2 |
| Molecular Weight | 1395.66 g/mol |
| Exact Mass | 1394.57 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3c4c(c2)n(-c2[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc2)[c-][n+]4-c2c(-c4ccc5oc6ccccc6c5c4)cc(-c4c(C([2H])([2H])[2H])cccc4C([2H])([2H])[2H])cc2-c2cc4c(cc2-c2ccccc2-3)C(C)(C)CCC4(C)C)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C86H68N4O2.Pt/c1-52-21-19-22-53(2)81(52)57-43-67(55-33-36-79-70(41-55)66-30-16-18-32-78(66)92-79)82-72(44-57)69-50-74-73(85(6,7)38-39-86(74,8)9)49-68(69)62-27-13-14-28-63(62)71-42-56(54-23-11-10-12-24-54)45-77-83(71)89(82)51-88(77)59-25-20-26-60(47-59)91-61-34-35-65-64-29-15-17-31-75(64)90(76(65)48-61)80-46-58(37-40-87-80)84(3,4)5;/h10-37,40-46,49-50H,38-39H2,1-9H3;/q-2;/i1D3,2D3,10D,11D,12D,23D,24D; |
| InChIKey | PNVYOZXETWWSIZ-BRCBRTIISA-N |
| XLogP | 22.07 |
| TPSA | 49.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 93 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1395.66 |
| LogP ≤ 5 | 22.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171046468 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171046468?
The IUPAC name of CID 171046468 (CID 171046468) is not available.
What is the SMILES notation for CID 171046468?
The canonical SMILES for CID 171046468 is [2H]c1c([2H])c([2H])c(-c2cc3c4c(c2)n(-c2[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc2)[c-][n+]4-c2c(-c4ccc5oc6ccccc6c5c4)cc(-c4c(C([2H])([2H])[2H])cccc4C([2H])([2H])[2H])cc2-c2cc4c(cc2-c2ccccc2-3)C(C)(C)CCC4(C)C)c([2H])c1[2H].[Pt].
What is the InChIKey of CID 171046468?
The InChIKey is PNVYOZXETWWSIZ-BRCBRTIISA-N. The full InChI is InChI=1S/C86H68N4O2.Pt/c1-52-21-19-22-53(2)81(52)57-43-67(55-33-36-79-70(41-55)66-30-16-18-32-78(66)92-79)82-72(44-57)69-50-74-73(85(6,7)38-39-86(74,8)9)49-68(69)62-27-13-14-28-63(62)71-42-56(54-23-11-10-12-24-54)45-77-83(71)89(82)51-88(77)59-25-20-26-60(47-59)91-61-34-35-65-64-29-15-17-31-75(64)90(76(65)48-61)80-46-58(37-40-87-80)84(3,4)5;/h10-37,40-46,49-50H,38-39H2,1-9H3;/q-2;/i1D3,2D3,10D,11D,12D,23D,24D;.
What are the key properties of CID 171046468?
CID 171046468 has a molecular weight of 1395.66 g/mol, XLogP of 22.07, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171046468 is sourced from PubChem (CID 171046468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).