C90H72N4OPt-2 — CID 171047289
CID 171047289 (PubChem CID 171047289) has the molecular formula C90H72N4OPt-2 and a molecular weight of 1438.78 g/mol.
| Compound Name | CID 171047289 |
|---|---|
| PubChem CID | 171047289 |
| Molecular Formula | C90H72N4OPt-2 |
| Molecular Weight | 1438.78 g/mol |
| Exact Mass | 1437.65 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2ccccc2-c2cc(-c4c([2H])c(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c([2H])c(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c4[2H])cc4c2[n+]([c-]n4-c2[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc2)-c2c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cccc2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C90H72N4O.Pt/c1-88(2,3)66-44-45-91-84(54-66)94-81-41-22-21-35-75(81)76-43-42-71(56-82(76)94)95-70-33-23-32-69(55-70)92-57-93-86-73(65-49-67(89(4,5)6)53-68(50-65)90(7,8)9)38-25-40-79(86)78-39-24-37-72(60-30-17-12-18-31-60)85(78)77-36-20-19-34-74(77)80-51-64(52-83(92)87(80)93)63-47-61(58-26-13-10-14-27-58)46-62(48-63)59-28-15-11-16-29-59;/h10-54H,1-9H3;/q-2;/i10D,11D,12D,13D,14D,15D,16D,17D,18D,26D,27D,28D,29D,30D,31D,46D,47D,48D; |
| InChIKey | YWAFXZIYSSLGFH-XPGKTHQPSA-N |
| XLogP | 23.13 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1438.78 |
| LogP ≤ 5 | 23.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|