About CID 171047829
CID 171047829 (PubChem CID 171047829) has the molecular formula C76H59N5OPt-2
and a molecular weight of 1259.46 g/mol.
Molecular Properties
| Compound Name | CID 171047829 |
| PubChem CID | 171047829 |
| Molecular Formula | C76H59N5OPt-2 |
| Molecular Weight | 1259.46 g/mol |
| Exact Mass | 1258.48 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1cc(C(C)(C)C)cc2c1-[n+]1[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c3cc(-n4c5ccccc5c5ccccc54)cc(c31)-c1ccccc1-c1ccccc1-2.[Pt] |
| InChI | InChI=1S/C76H59N5O.Pt/c1-47-21-19-22-48(2)72(47)65-40-50(76(6,7)8)39-63-57-27-11-9-25-55(57)56-26-10-12-28-58(56)64-43-52(80-66-32-16-13-29-59(66)60-30-14-17-33-67(60)80)44-70-74(64)79(73(63)65)46-78(70)51-23-20-24-53(42-51)82-54-35-36-62-61-31-15-18-34-68(61)81(69(62)45-54)71-41-49(37-38-77-71)75(3,4)5;/h9-41,43-44H,1-8H3;/q-2;/i1D3,2D3; |
| InChIKey | CRNIXSIWTAUBHV-TXHXQZCNSA-N |
| XLogP | 18.88 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 83 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1259.46 |
| LogP ≤ 5 | 18.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171047829 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171047829?
The IUPAC name of CID 171047829 (CID 171047829) is not available.
What is the SMILES notation for CID 171047829?
The canonical SMILES for CID 171047829 is [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1cc(C(C)(C)C)cc2c1-[n+]1[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c3cc(-n4c5ccccc5c5ccccc54)cc(c31)-c1ccccc1-c1ccccc1-2.[Pt].
What is the InChIKey of CID 171047829?
The InChIKey is CRNIXSIWTAUBHV-TXHXQZCNSA-N. The full InChI is InChI=1S/C76H59N5O.Pt/c1-47-21-19-22-48(2)72(47)65-40-50(76(6,7)8)39-63-57-27-11-9-25-55(57)56-26-10-12-28-58(56)64-43-52(80-66-32-16-13-29-59(66)60-30-14-17-33-67(60)80)44-70-74(64)79(73(63)65)46-78(70)51-23-20-24-53(42-51)82-54-35-36-62-61-31-15-18-34-68(61)81(69(62)45-54)71-41-49(37-38-77-71)75(3,4)5;/h9-41,43-44H,1-8H3;/q-2;/i1D3,2D3;.
What are the key properties of CID 171047829?
CID 171047829 has a molecular weight of 1259.46 g/mol, XLogP of 18.88, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171047829 is sourced from PubChem (CID 171047829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).